C18H22N4O2 — CID 71929756
N-(3-ethoxyspiro[3.3]heptan-1-yl)-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 71929756) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(3-ethoxyspiro[3.3]heptan-1-yl)-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(3-ethoxyspiro[3.3]heptan-1-yl)-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 71929756 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-(3-ethoxyspiro[3.3]heptan-1-yl)-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCOC1CC(NC(=O)c2ccc(-n3cncn3)cc2)C12CCC2 |
| InChI | InChI=1S/C18H22N4O2/c1-2-24-16-10-15(18(16)8-3-9-18)21-17(23)13-4-6-14(7-5-13)22-12-19-11-20-22/h4-7,11-12,15-16H,2-3,8-10H2,1H3,(H,21,23) |
| InChIKey | JVMVACLCCLOGSL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |