C20H23N3O2 — CID 97100560
N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-pyrimidin-5-ylbenzamide (PubChem CID 97100560) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-pyrimidin-5-ylbenzamide.
| Compound Name | N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-pyrimidin-5-ylbenzamide |
|---|---|
| PubChem CID | 97100560 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-pyrimidin-5-ylbenzamide |
| SMILES | CCO[C@@H]1C[C@@H](NC(=O)c2ccccc2-c2cncnc2)C12CCC2 |
| InChI | InChI=1S/C20H23N3O2/c1-2-25-18-10-17(20(18)8-5-9-20)23-19(24)16-7-4-3-6-15(16)14-11-21-13-22-12-14/h3-4,6-7,11-13,17-18H,2,5,8-10H2,1H3,(H,23,24)/t17-,18-/m1/s1 |
| InChIKey | OAKCOIJXNTUEFP-QZTJIDSGSA-N |
| XLogP | 3.22 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |