C19H22N2O2S — CID 99810928
N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-phenyl-1,3-thiazole-4-carboxamide (PubChem CID 99810928) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-phenyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-phenyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 99810928 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]-2-phenyl-1,3-thiazole-4-carboxamide |
| SMILES | CCO[C@@H]1C[C@@H](NC(=O)c2csc(-c3ccccc3)n2)C12CCC2 |
| InChI | InChI=1S/C19H22N2O2S/c1-2-23-16-11-15(19(16)9-6-10-19)21-17(22)14-12-24-18(20-14)13-7-4-3-5-8-13/h3-5,7-8,12,15-16H,2,6,9-11H2,1H3,(H,21,22)/t15-,16-/m1/s1 |
| InChIKey | IHACLRDBFVSHPM-HZPDHXFCSA-N |
| XLogP | 3.89 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |