C19H24N4O2 — CID 97100576
1-benzyl-N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]triazole-4-carboxamide (PubChem CID 97100576) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-benzyl-N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 97100576 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 1-benzyl-N-[(1R,3R)-3-ethoxyspiro[3.3]heptan-1-yl]triazole-4-carboxamide |
| SMILES | CCO[C@@H]1C[C@@H](NC(=O)c2cn(Cc3ccccc3)nn2)C12CCC2 |
| InChI | InChI=1S/C19H24N4O2/c1-2-25-17-11-16(19(17)9-6-10-19)20-18(24)15-13-23(22-21-15)12-14-7-4-3-5-8-14/h3-5,7-8,13,16-17H,2,6,9-12H2,1H3,(H,20,24)/t16-,17-/m1/s1 |
| InChIKey | LHDTWOKIOGJVFF-IAGOWNOFSA-N |
| XLogP | 2.40 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |