C19H18N4O2 — CID 111658731
1-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)triazole-4-carboxamide (PubChem CID 111658731) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 111658731 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-benzyl-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)triazole-4-carboxamide |
| SMILES | O=C(NC1c2ccccc2CC1O)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C19H18N4O2/c24-17-10-14-8-4-5-9-15(14)18(17)20-19(25)16-12-23(22-21-16)11-13-6-2-1-3-7-13/h1-9,12,17-18,24H,10-11H2,(H,20,25) |
| InChIKey | JGVSFDFJLBNXBL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |