C14H15N5O2 — CID 36706465
1-benzyl-N'-(cyclopropanecarbonyl)triazole-4-carbohydrazide (PubChem CID 36706465) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-benzyl-N'-(cyclopropanecarbonyl)triazole-4-carbohydrazide.
| Compound Name | 1-benzyl-N'-(cyclopropanecarbonyl)triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 36706465 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-benzyl-N'-(cyclopropanecarbonyl)triazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC1)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C14H15N5O2/c20-13(11-6-7-11)16-17-14(21)12-9-19(18-15-12)8-10-4-2-1-3-5-10/h1-5,9,11H,6-8H2,(H,16,20)(H,17,21) |
| InChIKey | UEBCWPPYGCLIFA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|