C19H20N6O2 — CID 25333094
1-benzyl-N'-[3-(dimethylamino)benzoyl]triazole-4-carbohydrazide (PubChem CID 25333094) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-benzyl-N'-[3-(dimethylamino)benzoyl]triazole-4-carbohydrazide.
| Compound Name | 1-benzyl-N'-[3-(dimethylamino)benzoyl]triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 25333094 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-benzyl-N'-[3-(dimethylamino)benzoyl]triazole-4-carbohydrazide |
| SMILES | CN(C)c1cccc(C(=O)NNC(=O)c2cn(Cc3ccccc3)nn2)c1 |
| InChI | InChI=1S/C19H20N6O2/c1-24(2)16-10-6-9-15(11-16)18(26)21-22-19(27)17-13-25(23-20-17)12-14-7-4-3-5-8-14/h3-11,13H,12H2,1-2H3,(H,21,26)(H,22,27) |
| InChIKey | JJBBTFKIQNUHGQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|