C18H19N5O2 — CID 37348998
N'-[3-(dimethylamino)benzoyl]-5-methylimidazo[1,2-a]pyridine-2-carbohydrazide (PubChem CID 37348998) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is N'-[3-(dimethylamino)benzoyl]-5-methylimidazo[1,2-a]pyridine-2-carbohydrazide.
| Compound Name | N'-[3-(dimethylamino)benzoyl]-5-methylimidazo[1,2-a]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 37348998 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N'-[3-(dimethylamino)benzoyl]-5-methylimidazo[1,2-a]pyridine-2-carbohydrazide |
| SMILES | Cc1cccc2nc(C(=O)NNC(=O)c3cccc(N(C)C)c3)cn12 |
| InChI | InChI=1S/C18H19N5O2/c1-12-6-4-9-16-19-15(11-23(12)16)18(25)21-20-17(24)13-7-5-8-14(10-13)22(2)3/h4-11H,1-3H3,(H,20,24)(H,21,25) |
| InChIKey | GKGFURYQXSSEKW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|