C15H17BrN4O2 — CID 24552605
4-bromo-N'-[3-(dimethylamino)benzoyl]-1-methylpyrrole-2-carbohydrazide (PubChem CID 24552605) has the molecular formula C15H17BrN4O2 and a molecular weight of 365.23 g/mol. Its IUPAC name is 4-bromo-N'-[3-(dimethylamino)benzoyl]-1-methylpyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[3-(dimethylamino)benzoyl]-1-methylpyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 24552605 |
| Molecular Formula | C15H17BrN4O2 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 4-bromo-N'-[3-(dimethylamino)benzoyl]-1-methylpyrrole-2-carbohydrazide |
| SMILES | CN(C)c1cccc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 |
| InChI | InChI=1S/C15H17BrN4O2/c1-19(2)12-6-4-5-10(7-12)14(21)17-18-15(22)13-8-11(16)9-20(13)3/h4-9H,1-3H3,(H,17,21)(H,18,22) |
| InChIKey | DQBPXZARAXGSAU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|