C12H11BrN4O3 — CID 18120355
N'-(4-bromo-1-methylpyrrole-2-carbonyl)-6-oxo-1H-pyridine-3-carbohydrazide (PubChem CID 18120355) has the molecular formula C12H11BrN4O3 and a molecular weight of 339.15 g/mol. Its IUPAC name is N'-(4-bromo-1-methylpyrrole-2-carbonyl)-6-oxo-1H-pyridine-3-carbohydrazide.
| Compound Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-6-oxo-1H-pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 18120355 |
| Molecular Formula | C12H11BrN4O3 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-6-oxo-1H-pyridine-3-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C12H11BrN4O3/c1-17-6-8(13)4-9(17)12(20)16-15-11(19)7-2-3-10(18)14-5-7/h2-6H,1H3,(H,14,18)(H,15,19)(H,16,20) |
| InChIKey | SPLWHTVFCKOMNR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|