C18H19BrN4O3 — CID 24533060
4-bromo-1-methyl-N'-[4-(2-oxopiperidin-1-yl)benzoyl]pyrrole-2-carbohydrazide (PubChem CID 24533060) has the molecular formula C18H19BrN4O3 and a molecular weight of 419.28 g/mol. Its IUPAC name is 4-bromo-1-methyl-N'-[4-(2-oxopiperidin-1-yl)benzoyl]pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-1-methyl-N'-[4-(2-oxopiperidin-1-yl)benzoyl]pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 24533060 |
| Molecular Formula | C18H19BrN4O3 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 4-bromo-1-methyl-N'-[4-(2-oxopiperidin-1-yl)benzoyl]pyrrole-2-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C18H19BrN4O3/c1-22-11-13(19)10-15(22)18(26)21-20-17(25)12-5-7-14(8-6-12)23-9-3-2-4-16(23)24/h5-8,10-11H,2-4,9H2,1H3,(H,20,25)(H,21,26) |
| InChIKey | TVGKWNAMSFWMLT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|