C19H20BrN5O4 — CID 24552630
N-[2-[2-(4-bromo-1-methylpyrrole-2-carbonyl)hydrazinyl]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 24552630) has the molecular formula C19H20BrN5O4 and a molecular weight of 462.30 g/mol. Its IUPAC name is N-[2-[2-(4-bromo-1-methylpyrrole-2-carbonyl)hydrazinyl]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-[2-(4-bromo-1-methylpyrrole-2-carbonyl)hydrazinyl]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 24552630 |
| Molecular Formula | C19H20BrN5O4 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | N-[2-[2-(4-bromo-1-methylpyrrole-2-carbonyl)hydrazinyl]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)CNC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H20BrN5O4/c1-24-11-13(20)9-15(24)19(29)23-22-16(26)10-21-18(28)12-4-6-14(7-5-12)25-8-2-3-17(25)27/h4-7,9,11H,2-3,8,10H2,1H3,(H,21,28)(H,22,26)(H,23,29) |
| InChIKey | FOOCGUDZXXOKFJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|