C16H13BrN4O2S — CID 24533043
N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-phenyl-1,3-thiazole-4-carbohydrazide (PubChem CID 24533043) has the molecular formula C16H13BrN4O2S and a molecular weight of 405.28 g/mol. Its IUPAC name is N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-phenyl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-phenyl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24533043 |
| Molecular Formula | C16H13BrN4O2S |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-phenyl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cn1cc(Br)cc1C(=O)NNC(=O)c1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H13BrN4O2S/c1-21-8-11(17)7-13(21)15(23)20-19-14(22)12-9-24-16(18-12)10-5-3-2-4-6-10/h2-9H,1H3,(H,19,22)(H,20,23) |
| InChIKey | GERCLMMKGUUVTF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|