C20H19N3O4S — CID 55438760
N'-(4-ethoxy-3-methoxybenzoyl)-2-phenyl-1,3-thiazole-4-carbohydrazide (PubChem CID 55438760) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is N'-(4-ethoxy-3-methoxybenzoyl)-2-phenyl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(4-ethoxy-3-methoxybenzoyl)-2-phenyl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55438760 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N'-(4-ethoxy-3-methoxybenzoyl)-2-phenyl-1,3-thiazole-4-carbohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2csc(-c3ccccc3)n2)cc1OC |
| InChI | InChI=1S/C20H19N3O4S/c1-3-27-16-10-9-14(11-17(16)26-2)18(24)22-23-19(25)15-12-28-20(21-15)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | ALNZEFLGJRILQP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|