C23H25N3O6S — CID 24503094
2-(3,4-dimethoxyphenyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]-1,3-thiazole-4-carbohydrazide (PubChem CID 24503094) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24503094 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N'-[2-(4-ethoxyphenoxy)propanoyl]-1,3-thiazole-4-carbohydrazide |
| SMILES | CCOc1ccc(OC(C)C(=O)NNC(=O)c2csc(-c3ccc(OC)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C23H25N3O6S/c1-5-31-16-7-9-17(10-8-16)32-14(2)21(27)25-26-22(28)18-13-33-23(24-18)15-6-11-19(29-3)20(12-15)30-4/h6-14H,5H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | VKAAXFLKVYVEND-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|