C15H13BrN4O2S2 — CID 24533036
N'-(4-bromo-1-methylpyrrole-2-carbonyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 24533036) has the molecular formula C15H13BrN4O2S2 and a molecular weight of 425.33 g/mol. Its IUPAC name is N'-(4-bromo-1-methylpyrrole-2-carbonyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24533036 |
| Molecular Formula | C15H13BrN4O2S2 |
| Molecular Weight | 425.33 g/mol |
| Exact Mass | 423.97 |
| IUPAC Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)NNC(=O)c1cc(Br)cn1C |
| InChI | InChI=1S/C15H13BrN4O2S2/c1-8-12(24-15(17-8)9-3-4-23-7-9)14(22)19-18-13(21)11-5-10(16)6-20(11)2/h3-7H,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | POIFQRBBNSJFKW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|