C10H7N3OS2 — CID 79194223
N-cyano-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 79194223) has the molecular formula C10H7N3OS2 and a molecular weight of 249.32 g/mol. Its IUPAC name is N-cyano-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-cyano-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 79194223 |
| Molecular Formula | C10H7N3OS2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | N-cyano-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)NC#N |
| InChI | InChI=1S/C10H7N3OS2/c1-6-8(9(14)12-5-11)16-10(13-6)7-2-3-15-4-7/h2-4H,1H3,(H,12,14) |
| InChIKey | UJKAPCRTZCWOFW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|