C18H14N4O3S2 — CID 9085819
N'-[2-(4-cyanophenoxy)acetyl]-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 9085819) has the molecular formula C18H14N4O3S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N'-[2-(4-cyanophenoxy)acetyl]-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[2-(4-cyanophenoxy)acetyl]-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 9085819 |
| Molecular Formula | C18H14N4O3S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N'-[2-(4-cyanophenoxy)acetyl]-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)NNC(=O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H14N4O3S2/c1-11-16(27-18(20-11)13-6-7-26-10-13)17(24)22-21-15(23)9-25-14-4-2-12(8-19)3-5-14/h2-7,10H,9H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | BDZWVLBDBBRVNN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|