C17H20N4O3S2 — CID 9093097
4-methyl-N'-[2-(2-oxoazepan-1-yl)acetyl]-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 9093097) has the molecular formula C17H20N4O3S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 4-methyl-N'-[2-(2-oxoazepan-1-yl)acetyl]-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-N'-[2-(2-oxoazepan-1-yl)acetyl]-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 9093097 |
| Molecular Formula | C17H20N4O3S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 4-methyl-N'-[2-(2-oxoazepan-1-yl)acetyl]-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)NNC(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C17H20N4O3S2/c1-11-15(26-17(18-11)12-6-8-25-10-12)16(24)20-19-13(22)9-21-7-4-2-3-5-14(21)23/h6,8,10H,2-5,7,9H2,1H3,(H,19,22)(H,20,24) |
| InChIKey | OYFJDNYGFRWRCN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|