C21H21N3O3S2 — CID 55427711
[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate (PubChem CID 55427711) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55427711 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)OCC(=O)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C21H21N3O3S2/c1-14-19(29-20(22-14)15-8-11-28-13-15)21(26)27-12-18(25)23-16-4-6-17(7-5-16)24-9-2-3-10-24/h4-8,11,13H,2-3,9-10,12H2,1H3,(H,23,25) |
| InChIKey | QXNOSZFRCYSIEO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|