C20H24N2O3S — CID 7594118
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2,5-dimethylthiophene-3-carboxylate (PubChem CID 7594118) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2,5-dimethylthiophene-3-carboxylate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7594118 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 2,5-dimethylthiophene-3-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2ccc(N3CCCCC3)cc2)c(C)s1 |
| InChI | InChI=1S/C20H24N2O3S/c1-14-12-18(15(2)26-14)20(24)25-13-19(23)21-16-6-8-17(9-7-16)22-10-4-3-5-11-22/h6-9,12H,3-5,10-11,13H2,1-2H3,(H,21,23) |
| InChIKey | DJLNGBCQBIYFFP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|