C23H28N2O5 — CID 9203566
[2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 2,4-dimethoxybenzoate (PubChem CID 9203566) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 2,4-dimethoxybenzoate.
| Compound Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 9203566 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [2-[4-(azepan-1-yl)anilino]-2-oxoethyl] 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(N3CCCCCC3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H28N2O5/c1-28-19-11-12-20(21(15-19)29-2)23(27)30-16-22(26)24-17-7-9-18(10-8-17)25-13-5-3-4-6-14-25/h7-12,15H,3-6,13-14,16H2,1-2H3,(H,24,26) |
| InChIKey | TWCDWHLMVMJCKP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|