C22H26N2O5 — CID 27891782
[2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2,4-dimethoxybenzoate (PubChem CID 27891782) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2,4-dimethoxybenzoate.
| Compound Name | [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 27891782 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2ccc(N3CCCC3)cc2C)c(OC)c1 |
| InChI | InChI=1S/C22H26N2O5/c1-15-12-16(24-10-4-5-11-24)6-9-19(15)23-21(25)14-29-22(26)18-8-7-17(27-2)13-20(18)28-3/h6-9,12-13H,4-5,10-11,14H2,1-3H3,(H,23,25) |
| InChIKey | UBNQUZJGFIHYPE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|