C19H19Cl2N3O3 — CID 27928519
[2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate (PubChem CID 27928519) has the molecular formula C19H19Cl2N3O3 and a molecular weight of 408.29 g/mol. Its IUPAC name is [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate.
| Compound Name | [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 27928519 |
| Molecular Formula | C19H19Cl2N3O3 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 3,6-dichloropyridine-2-carboxylate |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)COC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H19Cl2N3O3/c1-12-10-13(24-8-2-3-9-24)4-6-15(12)22-17(25)11-27-19(26)18-14(20)5-7-16(21)23-18/h4-7,10H,2-3,8-9,11H2,1H3,(H,22,25) |
| InChIKey | ASZQZPSONADBJI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|