C24H25N3O3 — CID 55503570
[2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2-quinolin-8-ylacetate (PubChem CID 55503570) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2-quinolin-8-ylacetate.
| Compound Name | [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2-quinolin-8-ylacetate |
|---|---|
| PubChem CID | 55503570 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2-quinolin-8-ylacetate |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)COC(=O)Cc1cccc2cccnc12 |
| InChI | InChI=1S/C24H25N3O3/c1-17-14-20(27-12-2-3-13-27)9-10-21(17)26-22(28)16-30-23(29)15-19-7-4-6-18-8-5-11-25-24(18)19/h4-11,14H,2-3,12-13,15-16H2,1H3,(H,26,28) |
| InChIKey | OXSCLJHLNFFETF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|