C21H28N6O — CID 26570264
N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide (PubChem CID 26570264) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide.
| Compound Name | N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 26570264 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)acetamide |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H28N6O/c1-17-15-18(26-9-2-3-10-26)5-6-19(17)24-20(28)16-25-11-13-27(14-12-25)21-22-7-4-8-23-21/h4-8,15H,2-3,9-14,16H2,1H3,(H,24,28) |
| InChIKey | ORDLVWULCXILNY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|