C22H30N4O3S2 — CID 26424229
N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 26424229) has the molecular formula C22H30N4O3S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 26424229 |
| Molecular Formula | C22H30N4O3S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-(2-methyl-4-pyrrolidin-1-ylphenyl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CC(=O)Nc3ccc(N4CCCC4)cc3C)CC2)s1 |
| InChI | InChI=1S/C22H30N4O3S2/c1-17-15-19(25-9-3-4-10-25)6-7-20(17)23-21(27)16-24-11-13-26(14-12-24)31(28,29)22-8-5-18(2)30-22/h5-8,15H,3-4,9-14,16H2,1-2H3,(H,23,27) |
| InChIKey | SVVWLUAIYXOOKU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|