C23H24F3N3O4 — CID 27916891
[2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 27916891) has the molecular formula C23H24F3N3O4 and a molecular weight of 463.46 g/mol. Its IUPAC name is [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 27916891 |
| Molecular Formula | C23H24F3N3O4 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [2-(2-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | Cc1cc(N2CCCC2)ccc1NC(=O)COC(=O)CNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H24F3N3O4/c1-15-12-18(29-10-2-3-11-29)8-9-19(15)28-20(30)14-33-21(31)13-27-22(32)16-4-6-17(7-5-16)23(24,25)26/h4-9,12H,2-3,10-11,13-14H2,1H3,(H,27,32)(H,28,30) |
| InChIKey | LBCCLBPUSLJZAU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|