C22H23N3O5 — CID 8653826
[2-(2-methylanilino)-2-oxoethyl] 2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetate (PubChem CID 8653826) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 8653826 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)CNC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H23N3O5/c1-15-5-2-3-6-18(15)24-19(26)14-30-21(28)13-23-22(29)16-8-10-17(11-9-16)25-12-4-7-20(25)27/h2-3,5-6,8-11H,4,7,12-14H2,1H3,(H,23,29)(H,24,26) |
| InChIKey | FXKRJFSQVKFDPU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |