C23H21N3O3 — CID 24637861
N-[2-(naphthalen-1-ylamino)-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 24637861) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[2-(naphthalen-1-ylamino)-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-(naphthalen-1-ylamino)-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 24637861 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[2-(naphthalen-1-ylamino)-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(CNC(=O)c1ccc(N2CCCC2=O)cc1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C23H21N3O3/c27-21(25-20-8-3-6-16-5-1-2-7-19(16)20)15-24-23(29)17-10-12-18(13-11-17)26-14-4-9-22(26)28/h1-3,5-8,10-13H,4,9,14-15H2,(H,24,29)(H,25,27) |
| InChIKey | SUJMOWHEMXKPPK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |