C23H24N4O4 — CID 46584847
N-[2-[3-(cyclopropanecarbonylamino)anilino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 46584847) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[2-[3-(cyclopropanecarbonylamino)anilino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-[3-(cyclopropanecarbonylamino)anilino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 46584847 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N-[2-[3-(cyclopropanecarbonylamino)anilino]-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | O=C(CNC(=O)c1ccc(N2CCCC2=O)cc1)Nc1cccc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C23H24N4O4/c28-20(25-17-3-1-4-18(13-17)26-23(31)16-6-7-16)14-24-22(30)15-8-10-19(11-9-15)27-12-2-5-21(27)29/h1,3-4,8-11,13,16H,2,5-7,12,14H2,(H,24,30)(H,25,28)(H,26,31) |
| InChIKey | ZFTBYYKOKWIEPI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |