C21H23N3O5 — CID 51218960
N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 51218960) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 51218960 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[2-(3,5-dimethoxyanilino)-2-oxoethyl]-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | COc1cc(NC(=O)CNC(=O)c2ccc(N3CCCC3=O)cc2)cc(OC)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-28-17-10-15(11-18(12-17)29-2)23-19(25)13-22-21(27)14-5-7-16(8-6-14)24-9-3-4-20(24)26/h5-8,10-12H,3-4,9,13H2,1-2H3,(H,22,27)(H,23,25) |
| InChIKey | JZNDVUFFAPSSTP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |