C24H27N3O5 — CID 35144060
butyl 4-[[2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetyl]amino]benzoate (PubChem CID 35144060) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is butyl 4-[[2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 35144060 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | butyl 4-[[2-[[4-(2-oxopyrrolidin-1-yl)benzoyl]amino]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CNC(=O)c2ccc(N3CCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O5/c1-2-3-15-32-24(31)18-6-10-19(11-7-18)26-21(28)16-25-23(30)17-8-12-20(13-9-17)27-14-4-5-22(27)29/h6-13H,2-5,14-16H2,1H3,(H,25,30)(H,26,28) |
| InChIKey | GNTBENLRWYYSHO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|