C19H14ClN3O5 — CID 55488507
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-quinolin-8-ylacetate (PubChem CID 55488507) has the molecular formula C19H14ClN3O5 and a molecular weight of 399.79 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-quinolin-8-ylacetate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-quinolin-8-ylacetate |
|---|---|
| PubChem CID | 55488507 |
| Molecular Formula | C19H14ClN3O5 |
| Molecular Weight | 399.79 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-quinolin-8-ylacetate |
| SMILES | O=C(COC(=O)Cc1cccc2cccnc12)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H14ClN3O5/c20-15-10-14(23(26)27)6-7-16(15)22-17(24)11-28-18(25)9-13-4-1-3-12-5-2-8-21-19(12)13/h1-8,10H,9,11H2,(H,22,24) |
| InChIKey | RKEWVIORZMHNDD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.79 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|