C22H28N2O3S — CID 7262631
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 5-methyl-4-propylthiophene-2-carboxylate (PubChem CID 7262631) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 5-methyl-4-propylthiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 5-methyl-4-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7262631 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 5-methyl-4-propylthiophene-2-carboxylate |
| SMILES | CCCc1cc(C(=O)OCC(=O)Nc2ccc(N3CCCCC3)cc2)sc1C |
| InChI | InChI=1S/C22H28N2O3S/c1-3-7-17-14-20(28-16(17)2)22(26)27-15-21(25)23-18-8-10-19(11-9-18)24-12-5-4-6-13-24/h8-11,14H,3-7,12-13,15H2,1-2H3,(H,23,25) |
| InChIKey | ZDGAXUXVXBEKHH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|