C21H25NO5S — CID 7418679
[2-oxo-2-(4-propan-2-yloxycarbonylanilino)ethyl] 5-methyl-4-propylthiophene-2-carboxylate (PubChem CID 7418679) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is [2-oxo-2-(4-propan-2-yloxycarbonylanilino)ethyl] 5-methyl-4-propylthiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(4-propan-2-yloxycarbonylanilino)ethyl] 5-methyl-4-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7418679 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [2-oxo-2-(4-propan-2-yloxycarbonylanilino)ethyl] 5-methyl-4-propylthiophene-2-carboxylate |
| SMILES | CCCc1cc(C(=O)OCC(=O)Nc2ccc(C(=O)OC(C)C)cc2)sc1C |
| InChI | InChI=1S/C21H25NO5S/c1-5-6-16-11-18(28-14(16)4)21(25)26-12-19(23)22-17-9-7-15(8-10-17)20(24)27-13(2)3/h7-11,13H,5-6,12H2,1-4H3,(H,22,23) |
| InChIKey | ZORROEJRWXIWIJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |