C18H21NO3S — CID 7683646
[2-(4-methylanilino)-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate (PubChem CID 7683646) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7683646 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate |
| SMILES | CCCc1cc(C(=O)OCC(=O)Nc2ccc(C)cc2)sc1C |
| InChI | InChI=1S/C18H21NO3S/c1-4-5-14-10-16(23-13(14)3)18(21)22-11-17(20)19-15-8-6-12(2)7-9-15/h6-10H,4-5,11H2,1-3H3,(H,19,20) |
| InChIKey | NMQZYLAHBIUXKQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |