C18H18F3NO3S — CID 7418951
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 5-methyl-4-propylthiophene-2-carboxylate (PubChem CID 7418951) has the molecular formula C18H18F3NO3S and a molecular weight of 385.41 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 5-methyl-4-propylthiophene-2-carboxylate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 5-methyl-4-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7418951 |
| Molecular Formula | C18H18F3NO3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 5-methyl-4-propylthiophene-2-carboxylate |
| SMILES | CCCc1cc(C(=O)OCC(=O)Nc2ccccc2C(F)(F)F)sc1C |
| InChI | InChI=1S/C18H18F3NO3S/c1-3-6-12-9-15(26-11(12)2)17(24)25-10-16(23)22-14-8-5-4-7-13(14)18(19,20)21/h4-5,7-9H,3,6,10H2,1-2H3,(H,22,23) |
| InChIKey | VQYDHVDBJNYMEX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |