C18H19F2NO4S — CID 7418690
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate (PubChem CID 7418690) has the molecular formula C18H19F2NO4S and a molecular weight of 383.42 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7418690 |
| Molecular Formula | C18H19F2NO4S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 5-methyl-4-propylthiophene-2-carboxylate |
| SMILES | CCCc1cc(C(=O)OCC(=O)Nc2ccccc2OC(F)F)sc1C |
| InChI | InChI=1S/C18H19F2NO4S/c1-3-6-12-9-15(26-11(12)2)17(23)24-10-16(22)21-13-7-4-5-8-14(13)25-18(19)20/h4-5,7-9,18H,3,6,10H2,1-2H3,(H,21,22) |
| InChIKey | QRJUYPMBVLPCNJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |