C18H15N3O6S2 — CID 46660116
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate (PubChem CID 46660116) has the molecular formula C18H15N3O6S2 and a molecular weight of 433.47 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 46660116 |
| Molecular Formula | C18H15N3O6S2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2sc(-c3ccsc3)nc2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15N3O6S2/c1-10-16(29-17(19-10)11-5-6-28-9-11)18(23)27-8-15(22)20-13-4-3-12(26-2)7-14(13)21(24)25/h3-7,9H,8H2,1-2H3,(H,20,22) |
| InChIKey | JEKLAHOXNDAFGM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|