C18H13N3O8S — CID 46806826
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 5-nitro-1-benzothiophene-2-carboxylate (PubChem CID 46806826) has the molecular formula C18H13N3O8S and a molecular weight of 431.38 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 5-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 5-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46806826 |
| Molecular Formula | C18H13N3O8S |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 5-nitro-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13N3O8S/c1-28-12-3-4-13(14(8-12)21(26)27)19-17(22)9-29-18(23)16-7-10-6-11(20(24)25)2-5-15(10)30-16/h2-8H,9H2,1H3,(H,19,22) |
| InChIKey | RNGOGESROZPPAD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|