C18H15NO6S — CID 8808561
(2,5-dimethoxyphenyl)methyl 5-nitro-1-benzothiophene-2-carboxylate (PubChem CID 8808561) has the molecular formula C18H15NO6S and a molecular weight of 373.39 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl 5-nitro-1-benzothiophene-2-carboxylate.
| Compound Name | (2,5-dimethoxyphenyl)methyl 5-nitro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8808561 |
| Molecular Formula | C18H15NO6S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl 5-nitro-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccc(OC)c(COC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)c1 |
| InChI | InChI=1S/C18H15NO6S/c1-23-14-4-5-15(24-2)12(8-14)10-25-18(20)17-9-11-7-13(19(21)22)3-6-16(11)26-17/h3-9H,10H2,1-2H3 |
| InChIKey | AEZSZPXXKMBHII-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|