C12H11N3O5 — CID 47035286
(2-methoxy-5-nitrophenyl)methyl 1H-pyrazole-5-carboxylate (PubChem CID 47035286) has the molecular formula C12H11N3O5 and a molecular weight of 277.24 g/mol. Its IUPAC name is (2-methoxy-5-nitrophenyl)methyl 1H-pyrazole-5-carboxylate.
| Compound Name | (2-methoxy-5-nitrophenyl)methyl 1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 47035286 |
| Molecular Formula | C12H11N3O5 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (2-methoxy-5-nitrophenyl)methyl 1H-pyrazole-5-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1COC(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C12H11N3O5/c1-19-11-3-2-9(15(17)18)6-8(11)7-20-12(16)10-4-5-13-14-10/h2-6H,7H2,1H3,(H,13,14) |
| InChIKey | YAKCMRYBJNLJRC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|