C15H13BrN2O7S — CID 31682750
(2-methoxy-5-nitrophenyl)methyl 2-bromo-5-sulfamoylbenzoate (PubChem CID 31682750) has the molecular formula C15H13BrN2O7S and a molecular weight of 445.25 g/mol. Its IUPAC name is (2-methoxy-5-nitrophenyl)methyl 2-bromo-5-sulfamoylbenzoate.
| Compound Name | (2-methoxy-5-nitrophenyl)methyl 2-bromo-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 31682750 |
| Molecular Formula | C15H13BrN2O7S |
| Molecular Weight | 445.25 g/mol |
| Exact Mass | 443.96 |
| IUPAC Name | (2-methoxy-5-nitrophenyl)methyl 2-bromo-5-sulfamoylbenzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1COC(=O)c1cc(S(N)(=O)=O)ccc1Br |
| InChI | InChI=1S/C15H13BrN2O7S/c1-24-14-5-2-10(18(20)21)6-9(14)8-25-15(19)12-7-11(26(17,22)23)3-4-13(12)16/h2-7H,8H2,1H3,(H2,17,22,23) |
| InChIKey | LDCRONOWJRNRAC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|