C19H16N2O7 — CID 55307194
(2-methoxy-5-nitrophenyl)methyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 55307194) has the molecular formula C19H16N2O7 and a molecular weight of 384.34 g/mol. Its IUPAC name is (2-methoxy-5-nitrophenyl)methyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | (2-methoxy-5-nitrophenyl)methyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 55307194 |
| Molecular Formula | C19H16N2O7 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (2-methoxy-5-nitrophenyl)methyl 3-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1COC(=O)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C19H16N2O7/c1-27-16-6-5-15(21(25)26)10-13(16)11-28-19(24)12-3-2-4-14(9-12)20-17(22)7-8-18(20)23/h2-6,9-10H,7-8,11H2,1H3 |
| InChIKey | DHJHZBDFZQGXTN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|