C17H13N3O6 — CID 17342490
3-(2,5-dioxopyrrolidin-1-yl)-N-(2-hydroxy-5-nitrophenyl)benzamide (PubChem CID 17342490) has the molecular formula C17H13N3O6 and a molecular weight of 355.31 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(2-hydroxy-5-nitrophenyl)benzamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(2-hydroxy-5-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 17342490 |
| Molecular Formula | C17H13N3O6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(2-hydroxy-5-nitrophenyl)benzamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1O)c1cccc(N2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C17H13N3O6/c21-14-5-4-12(20(25)26)9-13(14)18-17(24)10-2-1-3-11(8-10)19-15(22)6-7-16(19)23/h1-5,8-9,21H,6-7H2,(H,18,24) |
| InChIKey | NKMOJSRYQQITAJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|