C16H12FN3O5 — CID 60528345
N-(2-fluoro-5-nitrophenyl)-3-(2-oxo-1,3-oxazolidin-3-yl)benzamide (PubChem CID 60528345) has the molecular formula C16H12FN3O5 and a molecular weight of 345.29 g/mol. Its IUPAC name is N-(2-fluoro-5-nitrophenyl)-3-(2-oxo-1,3-oxazolidin-3-yl)benzamide.
| Compound Name | N-(2-fluoro-5-nitrophenyl)-3-(2-oxo-1,3-oxazolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 60528345 |
| Molecular Formula | C16H12FN3O5 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(2-fluoro-5-nitrophenyl)-3-(2-oxo-1,3-oxazolidin-3-yl)benzamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1F)c1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C16H12FN3O5/c17-13-5-4-12(20(23)24)9-14(13)18-15(21)10-2-1-3-11(8-10)19-6-7-25-16(19)22/h1-5,8-9H,6-7H2,(H,18,21) |
| InChIKey | FWRMDPNRXVMOIF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|