About 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate
3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate (PubChem CID 46574604) has the molecular formula C13H10N2O4S
and a molecular weight of 290.30 g/mol. Its IUPAC name is 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate |
| PubChem CID | 46574604 |
| Molecular Formula | C13H10N2O4S |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate |
| SMILES | N#CCCCOC(=O)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C13H10N2O4S/c14-5-1-2-6-19-13(16)12-8-9-7-10(15(17)18)3-4-11(9)20-12/h3-4,7-8H,1-2,6H2 |
| InChIKey | IIWARVAHYVXTNV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 93.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate?
The IUPAC name of 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate (CID 46574604) is 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate.
What is the SMILES notation for 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate?
The canonical SMILES for 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate is N#CCCCOC(=O)c1cc2cc([N+](=O)[O-])ccc2s1.
What is the InChIKey of 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate?
The InChIKey is IIWARVAHYVXTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O4S/c14-5-1-2-6-19-13(16)12-8-9-7-10(15(17)18)3-4-11(9)20-12/h3-4,7-8H,1-2,6H2.
What are the key properties of 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate?
3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate has a molecular weight of 290.30 g/mol, XLogP of 3.27, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyanopropyl 5-nitro-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 46574604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).