C23H25N5O3 — CID 7835801
[2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 5-methyl-2-phenyltriazole-4-carboxylate (PubChem CID 7835801) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 5-methyl-2-phenyltriazole-4-carboxylate.
| Compound Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 5-methyl-2-phenyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 7835801 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | [2-oxo-2-(4-piperidin-1-ylanilino)ethyl] 5-methyl-2-phenyltriazole-4-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)OCC(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H25N5O3/c1-17-22(26-28(25-17)20-8-4-2-5-9-20)23(30)31-16-21(29)24-18-10-12-19(13-11-18)27-14-6-3-7-15-27/h2,4-5,8-13H,3,6-7,14-16H2,1H3,(H,24,29) |
| InChIKey | RLYDCPMFLBDSFE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|