C16H16N4O4 — CID 30473149
[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 5-methyl-2-phenyltriazole-4-carboxylate (PubChem CID 30473149) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 5-methyl-2-phenyltriazole-4-carboxylate.
| Compound Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 5-methyl-2-phenyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 30473149 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 5-methyl-2-phenyltriazole-4-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)OCC(=O)N1CCCC1=O |
| InChI | InChI=1S/C16H16N4O4/c1-11-15(18-20(17-11)12-6-3-2-4-7-12)16(23)24-10-14(22)19-9-5-8-13(19)21/h2-4,6-7H,5,8-10H2,1H3 |
| InChIKey | JWPAAKJZZOSIJM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |